CAS 1269054-63-8 is the registry number for 2-(Pyridin-3-yl)thiazol-5-amine hydrochloride, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-pyridin-3-yl-1,3-thiazol-5-amine;hydrochloride (CAS 1269054-63-8) is a chemical compound with the molecular formula C8H8ClN3S and a molecular weight of 213.69 g/mol. IUPAC name: 2-pyridin-3-yl-1,3-thiazol-5-amine;hydrochloride. InChIKey: RHKWIMVESRDTKO-UHFFFAOYSA-N.
| Molecular formula | C8H8ClN3S |
|---|---|
| Molecular weight | 213.69 g/mol |
| IUPAC name | 2-pyridin-3-yl-1,3-thiazol-5-amine;hydrochloride |
| InChIKey | RHKWIMVESRDTKO-UHFFFAOYSA-N |
| SMILES | C1=CC(=CN=C1)C2=NC=C(S2)N.Cl |
Computed by PubChem (NCBI)