CAS 1065640-69-8 is the registry number for 3-Bromo-4-(2,2,2-trifluoroethoxy)benzonitrile, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 250mg, 1g.
3-bromo-4-(2,2,2-trifluoroethoxy)benzonitrile (CAS 1065640-69-8) is a chemical compound with the molecular formula C9H5BrF3NO and a molecular weight of 280.04 g/mol. IUPAC name: 3-bromo-4-(2,2,2-trifluoroethoxy)benzonitrile. InChIKey: ARCPUSSFLDUMHI-UHFFFAOYSA-N.
| Molecular formula | C9H5BrF3NO |
|---|---|
| Molecular weight | 280.04 g/mol |
| IUPAC name | 3-bromo-4-(2,2,2-trifluoroethoxy)benzonitrile |
| InChIKey | ARCPUSSFLDUMHI-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C#N)Br)OCC(F)(F)F |
Computed by PubChem (NCBI)