CAS 1092461-34-1 is the registry number for 3-Bromo-5-(trifluoromethoxy)phenylacetonitrile, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
2-[3-bromo-5-(trifluoromethoxy)phenyl]acetonitrile (CAS 1092461-34-1) is a chemical compound with the molecular formula C9H5BrF3NO and a molecular weight of 280.04 g/mol. IUPAC name: 2-[3-bromo-5-(trifluoromethoxy)phenyl]acetonitrile. InChIKey: WWIWPXWPBQBQIO-UHFFFAOYSA-N.
| Molecular formula | C9H5BrF3NO |
|---|---|
| Molecular weight | 280.04 g/mol |
| IUPAC name | 2-[3-bromo-5-(trifluoromethoxy)phenyl]acetonitrile |
| InChIKey | WWIWPXWPBQBQIO-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C=C1OC(F)(F)F)Br)CC#N |
Computed by PubChem (NCBI)