CAS 1211530-82-3 appears in our catalog under these names: 6-bromo-4-(trifluoromethyl)-2,3-dihydro-1H-indol-2-one, 95%, 6-bromo-4-(trifluoromethyl)-2,3-dihydro-1H-indol-2-one, 97%, 97%. Offered by: Chemat Brand, Chemat. Available pack sizes: on request, 100mg, 250mg, 500mg, 1g, 5g, 10g.
6-bromo-4-(trifluoromethyl)-1,3-dihydroindol-2-one (CAS 1211530-82-3) is a chemical compound with the molecular formula C9H5BrF3NO and a molecular weight of 280.04 g/mol. IUPAC name: 6-bromo-4-(trifluoromethyl)-1,3-dihydroindol-2-one. InChIKey: WZWKSYZOAXSNOU-UHFFFAOYSA-N.
| Molecular formula | C9H5BrF3NO |
|---|---|
| Molecular weight | 280.04 g/mol |
| IUPAC name | 6-bromo-4-(trifluoromethyl)-1,3-dihydroindol-2-one |
| InChIKey | WZWKSYZOAXSNOU-UHFFFAOYSA-N |
| SMILES | C1C2=C(C=C(C=C2NC1=O)Br)C(F)(F)F |
Computed by PubChem (NCBI)