CAS 1445995-71-0 appears in our catalog under these names: 5-Bromo-2-methoxy-3-(trifluoromethyl)benzonitrile, 95%, 5-Bromo-2-methoxy-3-(trifluoromethyl)benzonitrile, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g, 5g.
5-bromo-2-methoxy-3-(trifluoromethyl)benzonitrile (CAS 1445995-71-0) is a chemical compound with the molecular formula C9H5BrF3NO and a molecular weight of 280.04 g/mol. IUPAC name: 5-bromo-2-methoxy-3-(trifluoromethyl)benzonitrile. InChIKey: DRRKLNIALUYHQU-UHFFFAOYSA-N.
| Molecular formula | C9H5BrF3NO |
|---|---|
| Molecular weight | 280.04 g/mol |
| IUPAC name | 5-bromo-2-methoxy-3-(trifluoromethyl)benzonitrile |
| InChIKey | DRRKLNIALUYHQU-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C=C1C(F)(F)F)Br)C#N |
Computed by PubChem (NCBI)