CAS 1381944-30-4 is the registry number for 2-[5-Bromo-2-(trifluoromethoxy)phenyl]acetonitrile, 98%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg, 100mg.
2-[5-bromo-2-(trifluoromethoxy)phenyl]acetonitrile (CAS 1381944-30-4) is a chemical compound with the molecular formula C9H5BrF3NO and a molecular weight of 280.04 g/mol. IUPAC name: 2-[5-bromo-2-(trifluoromethoxy)phenyl]acetonitrile. InChIKey: CPMGKPWSHGWONW-UHFFFAOYSA-N.
| Molecular formula | C9H5BrF3NO |
|---|---|
| Molecular weight | 280.04 g/mol |
| IUPAC name | 2-[5-bromo-2-(trifluoromethoxy)phenyl]acetonitrile |
| InChIKey | CPMGKPWSHGWONW-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1Br)CC#N)OC(F)(F)F |
Computed by PubChem (NCBI)