Products 2940940-48-5
CAS 2940940-48-5 is the registry number for 5-bromo-6-(trifluoromethoxy)-1H-indole, 97%, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg.
5-bromo-6-(trifluoromethoxy)-1H-indole (CAS 2940940-48-5) is a chemical compound with the molecular formula C9H5BrF3NO and a molecular weight of 280.04 g/mol. IUPAC name: 5-bromo-6-(trifluoromethoxy)-1H-indole. InChIKey: IFOQNAHZOUWWJW-UHFFFAOYSA-N.
| Molecular formula | C9H5BrF3NO |
|---|---|
| Molecular weight | 280.04 g/mol |
| IUPAC name | 5-bromo-6-(trifluoromethoxy)-1H-indole |
| InChIKey | IFOQNAHZOUWWJW-UHFFFAOYSA-N |
| SMILES | C1=CNC2=CC(=C(C=C21)Br)OC(F)(F)F |
Computed by PubChem (NCBI)
Synonyms:
1H-Indole, 5-bromo-6-(trifluoromethoxy)-