Products 106637-42-7
CAS 106637-42-7 appears in our catalog under these names: Milrinone Impurity 9, Milrinone Impurity X, Milrinone Impurity 3, 2'-Methyl-6'-oxo-1',6'-dihydro-(2,3'-bipyridine)-5'-carbonitrile. Offered by: Chemat Brand, Hubei YoungXin, TRC. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg, 2,5g.
6-methyl-2-oxo-5-pyridin-2-yl-1H-pyridine-3-carbonitrile (CAS 106637-42-7) is a chemical compound with the molecular formula C12H9N3O and a molecular weight of 211.22 g/mol. IUPAC name: 6-methyl-2-oxo-5-pyridin-2-yl-1H-pyridine-3-carbonitrile. InChIKey: RNDMGBQAVCPZSB-UHFFFAOYSA-N.
| Molecular formula | C12H9N3O |
|---|---|
| Molecular weight | 211.22 g/mol |
| IUPAC name | 6-methyl-2-oxo-5-pyridin-2-yl-1H-pyridine-3-carbonitrile |
| InChIKey | RNDMGBQAVCPZSB-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C(=O)N1)C#N)C2=CC=CC=N2 |
Computed by PubChem (NCBI)