CAS 106833-80-1 appears in our catalog under these names: 2-(Thiophen-2-yl)-1,3-oxazole-5-carboxylic acid, 95%, 2-(Thiophen-2-yl)-1,3-oxazole-5-carboxylic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
2-thiophen-2-yl-1,3-oxazole-5-carboxylic acid (CAS 106833-80-1) is a chemical compound with the molecular formula C8H5NO3S and a molecular weight of 195.20 g/mol. IUPAC name: 2-thiophen-2-yl-1,3-oxazole-5-carboxylic acid. InChIKey: CCYJSBIENSYLFK-UHFFFAOYSA-N.
| Molecular formula | C8H5NO3S |
|---|---|
| Molecular weight | 195.20 g/mol |
| IUPAC name | 2-thiophen-2-yl-1,3-oxazole-5-carboxylic acid |
| InChIKey | CCYJSBIENSYLFK-UHFFFAOYSA-N |
| SMILES | C1=CSC(=C1)C2=NC=C(O2)C(=O)O |
Computed by PubChem (NCBI)