CAS 99615-68-6 is the registry number for 2-Hydroxybenzo(d)thiazole-6-carboxylic acid, 95+%. Offered by: AmBeed. Available pack sizes: 5g.
2-oxo-3H-1,3-benzothiazole-6-carboxylic acid (CAS 99615-68-6) is a chemical compound with the molecular formula C8H5NO3S and a molecular weight of 195.20 g/mol. IUPAC name: 2-oxo-3H-1,3-benzothiazole-6-carboxylic acid. InChIKey: USZSGINUZRHINQ-UHFFFAOYSA-N.
| Molecular formula | C8H5NO3S |
|---|---|
| Molecular weight | 195.20 g/mol |
| IUPAC name | 2-oxo-3H-1,3-benzothiazole-6-carboxylic acid |
| InChIKey | USZSGINUZRHINQ-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1C(=O)O)SC(=O)N2 |
Computed by PubChem (NCBI)