Products 99615-68-6

CAS 99615-68-6 is the registry number for 2-Hydroxybenzo(d)thiazole-6-carboxylic acid, 95+%. Offered by: AmBeed. Available pack sizes: 5g.

Structural formula: {0} (CAS {1})

2-oxo-3H-1,3-benzothiazole-6-carboxylic acid (CAS 99615-68-6) is a chemical compound with the molecular formula C8H5NO3S and a molecular weight of 195.20 g/mol. IUPAC name: 2-oxo-3H-1,3-benzothiazole-6-carboxylic acid. InChIKey: USZSGINUZRHINQ-UHFFFAOYSA-N.

Identity
Molecular formulaC8H5NO3S
Molecular weight195.20 g/mol
IUPAC name2-oxo-3H-1,3-benzothiazole-6-carboxylic acid
InChIKeyUSZSGINUZRHINQ-UHFFFAOYSA-N
SMILESC1=CC2=C(C=C1C(=O)O)SC(=O)N2

Computed by PubChem (NCBI)