CAS 108085-62-7 appears in our catalog under these names: 2-Mercaptobenzo(d)oxazole-6-carboxylic acid, 97%, 2-Sulfanyl-1,3-benzoxazole-6-carboxylic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 1g, 100mg.
2-sulfanylidene-3H-1,3-benzoxazole-6-carboxylic acid (CAS 108085-62-7) is a chemical compound with the molecular formula C8H5NO3S and a molecular weight of 195.20 g/mol. IUPAC name: 2-sulfanylidene-3H-1,3-benzoxazole-6-carboxylic acid. InChIKey: PCYGQWDOXVVKLM-UHFFFAOYSA-N.
| Molecular formula | C8H5NO3S |
|---|---|
| Molecular weight | 195.20 g/mol |
| IUPAC name | 2-sulfanylidene-3H-1,3-benzoxazole-6-carboxylic acid |
| InChIKey | PCYGQWDOXVVKLM-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1C(=O)O)OC(=S)N2 |
Computed by PubChem (NCBI)