CAS 90691-08-0 appears in our catalog under these names: 7-Oxo-4,7-dihydrothieno(3,2-b)pyridine-6-carboxylic acid, 97%, 7-Oxo-4，7-Dihydrothieno[3，2-b]Pyridine-6-Carboxylic Acid, 97%, 97%, 7-Oxo-4,7-dihydrothieno[3,2-b]pyridine-6-carboxylic acid, 97%. Offered by: AmBeed, Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 5g.
7-oxo-4H-thieno[3,2-b]pyridine-6-carboxylic acid (CAS 90691-08-0) is a chemical compound with the molecular formula C8H5NO3S and a molecular weight of 195.20 g/mol. IUPAC name: 7-oxo-4H-thieno[3,2-b]pyridine-6-carboxylic acid. InChIKey: HEPABYGAAPNZES-UHFFFAOYSA-N.
| Molecular formula | C8H5NO3S |
|---|---|
| Molecular weight | 195.20 g/mol |
| IUPAC name | 7-oxo-4H-thieno[3,2-b]pyridine-6-carboxylic acid |
| InChIKey | HEPABYGAAPNZES-UHFFFAOYSA-N |
| SMILES | C1=CSC2=C1NC=C(C2=O)C(=O)O |
Computed by PubChem (NCBI)