CAS 115299-13-3 appears in our catalog under these names: 2-(2-Furyl)-1,3-thiazolidine-4-carboxylic acid, 95%, 2-Furan-2-yl-thiazolidine-4-carboxylic acid. Offered by: Combi-blocks, Biosynth. Available pack sizes: 1g, 10g, 5g, 0,5g.
2-(furan-2-yl)-1,3-thiazole-4-carboxylic acid (CAS 115299-13-3) is a chemical compound with the molecular formula C8H5NO3S and a molecular weight of 195.20 g/mol. IUPAC name: 2-(furan-2-yl)-1,3-thiazole-4-carboxylic acid. InChIKey: HYMZKFYFRXCTCA-UHFFFAOYSA-N.
| Molecular formula | C8H5NO3S |
|---|---|
| Molecular weight | 195.20 g/mol |
| IUPAC name | 2-(furan-2-yl)-1,3-thiazole-4-carboxylic acid |
| InChIKey | HYMZKFYFRXCTCA-UHFFFAOYSA-N |
| SMILES | C1=COC(=C1)C2=NC(=CS2)C(=O)O |
Computed by PubChem (NCBI)