CAS 1094230-08-6 appears in our catalog under these names: 2-(Furan-2-yl)-1,3-thiazole-5-carboxylic acid, 95%, 2-(Furan-2-yl)-1,3-thiazole-5-carboxylic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 100mg, 1g.
2-(furan-2-yl)-1,3-thiazole-5-carboxylic acid (CAS 1094230-08-6) is a chemical compound with the molecular formula C8H5NO3S and a molecular weight of 195.20 g/mol. IUPAC name: 2-(furan-2-yl)-1,3-thiazole-5-carboxylic acid. InChIKey: PKXIBGCQUJMWRQ-UHFFFAOYSA-N.
| Molecular formula | C8H5NO3S |
|---|---|
| Molecular weight | 195.20 g/mol |
| IUPAC name | 2-(furan-2-yl)-1,3-thiazole-5-carboxylic acid |
| InChIKey | PKXIBGCQUJMWRQ-UHFFFAOYSA-N |
| SMILES | C1=COC(=C1)C2=NC=C(S2)C(=O)O |
Computed by PubChem (NCBI)