CAS 1360953-85-0 is the registry number for 7-hydroxythieno[2,3-c]pyridine-4-carboxylic acid, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
7-oxo-6H-thieno[2,3-c]pyridine-4-carboxylic acid (CAS 1360953-85-0) is a chemical compound with the molecular formula C8H5NO3S and a molecular weight of 195.20 g/mol. IUPAC name: 7-oxo-6H-thieno[2,3-c]pyridine-4-carboxylic acid. InChIKey: HMFCVIXXVCXBBM-UHFFFAOYSA-N.
| Molecular formula | C8H5NO3S |
|---|---|
| Molecular weight | 195.20 g/mol |
| IUPAC name | 7-oxo-6H-thieno[2,3-c]pyridine-4-carboxylic acid |
| InChIKey | HMFCVIXXVCXBBM-UHFFFAOYSA-N |
| SMILES | C1=CSC2=C1C(=CNC2=O)C(=O)O |
Computed by PubChem (NCBI)