Products 1540927-08-9
CAS 1540927-08-9 is the registry number for 5-Oxothiazolo[3,2-a]pyridine-8-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
5-oxo-[1,3]thiazolo[3,2-a]pyridine-8-carboxylic acid (CAS 1540927-08-9) is a chemical compound with the molecular formula C8H5NO3S and a molecular weight of 195.20 g/mol. IUPAC name: 5-oxo-[1,3]thiazolo[3,2-a]pyridine-8-carboxylic acid. InChIKey: NDXJLILXPKUCSL-UHFFFAOYSA-N.
| Molecular formula | C8H5NO3S |
|---|---|
| Molecular weight | 195.20 g/mol |
| IUPAC name | 5-oxo-[1,3]thiazolo[3,2-a]pyridine-8-carboxylic acid |
| InChIKey | NDXJLILXPKUCSL-UHFFFAOYSA-N |
| SMILES | C1=CC(=O)N2C=CSC2=C1C(=O)O |
Computed by PubChem (NCBI)