Products 1070880-14-6
CAS 1070880-14-6 appears in our catalog under these names: 8–Chloro–6–methyl–2–propyl–4–quinolinol, 8-Chloro-6-methyl-2-propylquinolin-4-ol, 98%, 98%, 8-chloro-6-methyl-2-propyl-1,4-dihydroquinolin-4-one, 98%. Offered by: GLPBio, Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 500mg, 1g.
8-chloro-6-methyl-2-propyl-1H-quinolin-4-one (CAS 1070880-14-6) is a chemical compound with the molecular formula C13H14ClNO and a molecular weight of 235.71 g/mol. IUPAC name: 8-chloro-6-methyl-2-propyl-1H-quinolin-4-one. InChIKey: IKBKNEJXIKNURO-UHFFFAOYSA-N.
| Molecular formula | C13H14ClNO |
|---|---|
| Molecular weight | 235.71 g/mol |
| IUPAC name | 8-chloro-6-methyl-2-propyl-1H-quinolin-4-one |
| InChIKey | IKBKNEJXIKNURO-UHFFFAOYSA-N |
| SMILES | CCCC1=CC(=O)C2=C(N1)C(=CC(=C2)C)Cl |
Computed by PubChem (NCBI)