CAS 24168-09-0 is the registry number for 2,6-Dichloro-7,8-dimethyl-7H-purine. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
2,6-dichloro-7,8-dimethylpurine (CAS 24168-09-0) is a chemical compound with the molecular formula C7H6Cl2N4 and a molecular weight of 217.05 g/mol. IUPAC name: 2,6-dichloro-7,8-dimethylpurine. InChIKey: QOYAVUQDQACXGC-UHFFFAOYSA-N.
| Molecular formula | C7H6Cl2N4 |
|---|---|
| Molecular weight | 217.05 g/mol |
| IUPAC name | 2,6-dichloro-7,8-dimethylpurine |
| InChIKey | QOYAVUQDQACXGC-UHFFFAOYSA-N |
| SMILES | CC1=NC2=C(N1C)C(=NC(=N2)Cl)Cl |
Computed by PubChem (NCBI)