Products 928767-18-4
CAS 928767-18-4 appears in our catalog under these names: 5,7-dichloro-1-ethyl-1H-pyrazolo(4,3-d)pyrimidine, 97%, 5,7-dichloro-1-ethyl-1H-pyrazolo[4,3-d]pyrimidine, 97%, 97%. Offered by: AmBeed, Chemat. Available pack sizes: 5g, 100mg, 250mg, 500mg, 1g.
5,7-dichloro-1-ethylpyrazolo[4,5-d]pyrimidine (CAS 928767-18-4) is a chemical compound with the molecular formula C7H6Cl2N4 and a molecular weight of 217.05 g/mol. IUPAC name: 5,7-dichloro-1-ethylpyrazolo[4,5-d]pyrimidine. InChIKey: AANGWRILLZTMJI-UHFFFAOYSA-N.
| Molecular formula | C7H6Cl2N4 |
|---|---|
| Molecular weight | 217.05 g/mol |
| IUPAC name | 5,7-dichloro-1-ethylpyrazolo[4,5-d]pyrimidine |
| InChIKey | AANGWRILLZTMJI-UHFFFAOYSA-N |
| SMILES | CCN1C2=C(C=N1)N=C(N=C2Cl)Cl |
Computed by PubChem (NCBI)