CAS 1474018-06-8 appears in our catalog under these names: 2,6–Dichloro–8,9–dimethyl–9H–purine, 2,6-Dichloro-8,9-dimethyl-9H-purine 97%. Offered by: GLPBio, Ambeed. Available pack sizes: 100mg, 250mg, 1g, 5g.
2,6-dichloro-8,9-dimethylpurine (CAS 1474018-06-8) is a chemical compound with the molecular formula C7H6Cl2N4 and a molecular weight of 217.05 g/mol. IUPAC name: 2,6-dichloro-8,9-dimethylpurine. InChIKey: ROQDXPSEHZRJGV-UHFFFAOYSA-N.
| Molecular formula | C7H6Cl2N4 |
|---|---|
| Molecular weight | 217.05 g/mol |
| IUPAC name | 2,6-dichloro-8,9-dimethylpurine |
| InChIKey | ROQDXPSEHZRJGV-UHFFFAOYSA-N |
| SMILES | CC1=NC2=C(N1C)N=C(N=C2Cl)Cl |
Computed by PubChem (NCBI)