CAS 190654-80-9 appears in our catalog under these names: 2,6-Dichloro-7-ethyl-7H-purine, 97%, 97%, 2,6-DICHLORO-7-ETHYL-7H-PURINE, 97%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g.
2,6-dichloro-7-ethylpurine (CAS 190654-80-9) is a chemical compound with the molecular formula C7H6Cl2N4 and a molecular weight of 217.05 g/mol. IUPAC name: 2,6-dichloro-7-ethylpurine. InChIKey: OXRKNOIREWJPSD-UHFFFAOYSA-N.
| Molecular formula | C7H6Cl2N4 |
|---|---|
| Molecular weight | 217.05 g/mol |
| IUPAC name | 2,6-dichloro-7-ethylpurine |
| InChIKey | OXRKNOIREWJPSD-UHFFFAOYSA-N |
| SMILES | CCN1C=NC2=C1C(=NC(=N2)Cl)Cl |
Computed by PubChem (NCBI)