Products 1823331-38-9
CAS 1823331-38-9 appears in our catalog under these names: 5,7-Dichloro-2-ethyl-2h-pyrazolo[4,3-d]pyrimidine, 95%, 5,7-dichloro-2-ethyl-2H-pyrazolo[4,3-d]pyrimidine, 97%, 97%, 5,7-DICHLORO-2-ETHYL-2H-PYRAZOLO[4,3-D]PYRIMIDINE, 97%. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 25g, 250mg, 1g, 5g, 100mg, 500mg.
5,7-dichloro-2-ethylpyrazolo[4,3-d]pyrimidine (CAS 1823331-38-9) is a chemical compound with the molecular formula C7H6Cl2N4 and a molecular weight of 217.05 g/mol. IUPAC name: 5,7-dichloro-2-ethylpyrazolo[4,3-d]pyrimidine. InChIKey: BWHAJCRXKMRHKV-UHFFFAOYSA-N.
| Molecular formula | C7H6Cl2N4 |
|---|---|
| Molecular weight | 217.05 g/mol |
| IUPAC name | 5,7-dichloro-2-ethylpyrazolo[4,3-d]pyrimidine |
| InChIKey | BWHAJCRXKMRHKV-UHFFFAOYSA-N |
| SMILES | CCN1C=C2C(=N1)C(=NC(=N2)Cl)Cl |
Computed by PubChem (NCBI)