Products 2090969-59-6
CAS 2090969-59-6 is the registry number for 2,5-Dichloro-N-methyl-7H-pyrrolo[2,3-d]pyrimidin-4-amine, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
2,5-dichloro-N-methyl-7H-pyrrolo[2,3-d]pyrimidin-4-amine (CAS 2090969-59-6) is a chemical compound with the molecular formula C7H6Cl2N4 and a molecular weight of 217.05 g/mol. IUPAC name: 2,5-dichloro-N-methyl-7H-pyrrolo[2,3-d]pyrimidin-4-amine. InChIKey: JAYPLLXJEVITQT-UHFFFAOYSA-N.
| Molecular formula | C7H6Cl2N4 |
|---|---|
| Molecular weight | 217.05 g/mol |
| IUPAC name | 2,5-dichloro-N-methyl-7H-pyrrolo[2,3-d]pyrimidin-4-amine |
| InChIKey | JAYPLLXJEVITQT-UHFFFAOYSA-N |
| SMILES | CNC1=NC(=NC2=C1C(=CN2)Cl)Cl |
Computed by PubChem (NCBI)