CAS 928767-13-9 is the registry number for 5,7-Dichloro-1,3-dimethyl-1H-pyrazolo(4,3-d)pyrimidine, 95%. Offered by: AmBeed. Available pack sizes: 1g, 5g.
5,7-dichloro-1,3-dimethylpyrazolo[4,5-d]pyrimidine (CAS 928767-13-9) is a chemical compound with the molecular formula C7H6Cl2N4 and a molecular weight of 217.05 g/mol. IUPAC name: 5,7-dichloro-1,3-dimethylpyrazolo[4,5-d]pyrimidine. InChIKey: MHFLDOLCQFHARQ-UHFFFAOYSA-N.
| Molecular formula | C7H6Cl2N4 |
|---|---|
| Molecular weight | 217.05 g/mol |
| IUPAC name | 5,7-dichloro-1,3-dimethylpyrazolo[4,5-d]pyrimidine |
| InChIKey | MHFLDOLCQFHARQ-UHFFFAOYSA-N |
| SMILES | CC1=NN(C2=C1N=C(N=C2Cl)Cl)C |
Computed by PubChem (NCBI)