CAS 1072901-59-7 appears in our catalog under these names: Fmoc-3-amino-4-methylbenzoic acid, 97%, 3-((((9H-Fluoren-9-yl)methoxy)carbonyl)amino)-4-methylbenzoic acid, 95%, Fmoc–3–amino–4–methylbenzoic Acid, Fmoc-3-amino-4-methylbenzoic acid, Fmoc-3-Amino-4-MethylBenzoic acid 95%. Offered by: Combi-blocks, AmBeed, GLPBio, Biosynth, Chemat. Available pack sizes: 10g, 5g, 1g, 250mg, 25mg, 2,5g, 100mg.
3-(9H-fluoren-9-ylmethoxycarbonylamino)-4-methylbenzoic acid (CAS 1072901-59-7) is a chemical compound with the molecular formula C23H19NO4 and a molecular weight of 373.4 g/mol. IUPAC name: 3-(9H-fluoren-9-ylmethoxycarbonylamino)-4-methylbenzoic acid. InChIKey: MNLLXICLNDZTOF-UHFFFAOYSA-N.
| Molecular formula | C23H19NO4 |
|---|---|
| Molecular weight | 373.4 g/mol |
| IUPAC name | 3-(9H-fluoren-9-ylmethoxycarbonylamino)-4-methylbenzoic acid |
| InChIKey | MNLLXICLNDZTOF-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)C(=O)O)NC(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24 |
Computed by PubChem (NCBI)