CAS 173690-53-4 appears in our catalog under these names: Fmoc-4-APAc-OH, Fmoc-4-aminophenylacetic acid 95%, (4-{[(9H-fluoren-9-ylmethoxy)carbonyl]amino}phenyl)acetic acid, 98%, 2-(4-((((9H-Fluoren-9-yl)methoxy)carbonyl)amino)phenyl)acetic acid, 98%. Offered by: Iris Biotech, Ambeed, Combi-blocks, Fluorochem. Available pack sizes: 5g, 25g, 250mg, 1g, 100mg, 500mg, 2.5g, 10g.
2-[4-(9H-fluoren-9-ylmethoxycarbonylamino)phenyl]acetic acid (CAS 173690-53-4) is a chemical compound with the molecular formula C23H19NO4 and a molecular weight of 373.4 g/mol. IUPAC name: 2-[4-(9H-fluoren-9-ylmethoxycarbonylamino)phenyl]acetic acid. InChIKey: YRZJNRXNEUSRLW-UHFFFAOYSA-N.
| Molecular formula | C23H19NO4 |
|---|---|
| Molecular weight | 373.4 g/mol |
| IUPAC name | 2-[4-(9H-fluoren-9-ylmethoxycarbonylamino)phenyl]acetic acid |
| InChIKey | YRZJNRXNEUSRLW-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)NC4=CC=C(C=C4)CC(=O)O |
Computed by PubChem (NCBI)