CAS 155369-11-2 appears in our catalog under these names: Fmoc-3-aminomethylbenzoic acid, 95%, Fmoc-3-Amb-OH, Fmoc-3-Amb-OH 98%, 3-[[(Fmoc)amino]methyl]benzoic acid, 98%, 98%, 3-(((((9H-Fluoren-9-yl)methoxy)carbonyl)amino)methyl)benzoic acid, 98%. Offered by: Combi-blocks, Iris Biotech, Ambeed, Chemat, Fluorochem. Available pack sizes: 25g, 1g, 5g, 250mg, 10g, 100g.
3-[(9H-fluoren-9-ylmethoxycarbonylamino)methyl]benzoic acid (CAS 155369-11-2) is a chemical compound with the molecular formula C23H19NO4 and a molecular weight of 373.4 g/mol. IUPAC name: 3-[(9H-fluoren-9-ylmethoxycarbonylamino)methyl]benzoic acid. InChIKey: VODSFAVGEJUBHO-UHFFFAOYSA-N.
| Molecular formula | C23H19NO4 |
|---|---|
| Molecular weight | 373.4 g/mol |
| IUPAC name | 3-[(9H-fluoren-9-ylmethoxycarbonylamino)methyl]benzoic acid |
| InChIKey | VODSFAVGEJUBHO-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)NCC4=CC(=CC=C4)C(=O)O |
Computed by PubChem (NCBI)