Products 163883-97-4

CAS 163883-97-4 is the registry number for 2-([(9H-Fluoren-9-ylmethoxy)carbonyl]amino)-2-phenylacetic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 25g, 5g, 1g.

Structural formula: {0} (CAS {1})

2-(9H-fluoren-9-ylmethoxycarbonylamino)-2-phenylacetic acid (CAS 163883-97-4) is a chemical compound with the molecular formula C23H19NO4 and a molecular weight of 373.4 g/mol. IUPAC name: 2-(9H-fluoren-9-ylmethoxycarbonylamino)-2-phenylacetic acid. InChIKey: PCJHOCNJLMFYCV-UHFFFAOYSA-N.

Identity
Molecular formulaC23H19NO4
Molecular weight373.4 g/mol
IUPAC name2-(9H-fluoren-9-ylmethoxycarbonylamino)-2-phenylacetic acid
InChIKeyPCJHOCNJLMFYCV-UHFFFAOYSA-N
SMILESC1=CC=C(C=C1)C(C(=O)O)NC(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24

Computed by PubChem (NCBI)