CAS 163883-97-4 is the registry number for 2-([(9H-Fluoren-9-ylmethoxy)carbonyl]amino)-2-phenylacetic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 25g, 5g, 1g.
2-(9H-fluoren-9-ylmethoxycarbonylamino)-2-phenylacetic acid (CAS 163883-97-4) is a chemical compound with the molecular formula C23H19NO4 and a molecular weight of 373.4 g/mol. IUPAC name: 2-(9H-fluoren-9-ylmethoxycarbonylamino)-2-phenylacetic acid. InChIKey: PCJHOCNJLMFYCV-UHFFFAOYSA-N.
| Molecular formula | C23H19NO4 |
|---|---|
| Molecular weight | 373.4 g/mol |
| IUPAC name | 2-(9H-fluoren-9-ylmethoxycarbonylamino)-2-phenylacetic acid |
| InChIKey | PCJHOCNJLMFYCV-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(C(=O)O)NC(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24 |
Computed by PubChem (NCBI)