CAS 186320-08-1 appears in our catalog under these names: 3-(Fmoc-amino)phenylacetic acid, 95%, 3–(Fmoc–amino)phenylacetic Acid, Fmoc-3-APAc-OH, 3-(Fmoc-amino)phenylacetic acid 95%, 2-(3-((((9H-Fluoren-9-yl)methoxy)carbonyl)amino)phenyl)acetic acid, 95%, 95%. Offered by: Combi-blocks, GLPBio, Iris Biotech, Ambeed, Chemat. Available pack sizes: 250mg, 5g, 1g, 100mg.
2-[3-(9H-fluoren-9-ylmethoxycarbonylamino)phenyl]acetic acid (CAS 186320-08-1) is a chemical compound with the molecular formula C23H19NO4 and a molecular weight of 373.4 g/mol. IUPAC name: 2-[3-(9H-fluoren-9-ylmethoxycarbonylamino)phenyl]acetic acid. InChIKey: DFSRRXZHWJUCFU-UHFFFAOYSA-N.
| Molecular formula | C23H19NO4 |
|---|---|
| Molecular weight | 373.4 g/mol |
| IUPAC name | 2-[3-(9H-fluoren-9-ylmethoxycarbonylamino)phenyl]acetic acid |
| InChIKey | DFSRRXZHWJUCFU-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)NC4=CC=CC(=C4)CC(=O)O |
Computed by PubChem (NCBI)