CAS 219640-94-5 appears in our catalog under these names: 2-(Fmoc-aminomethyl)-benzoic acid, 95%, 2-(((((9H-Fluoren-9-yl)methoxy)carbonyl)amino)methyl)benzoic acid, 98%, Fmoc-2-Amb-OH, Fmoc-(2-aminomethyl) benzoic acid 98%, Fmoc-(2-aminomethyl) benzoic acid, 98%, 98%. Offered by: Combi-blocks, AmBeed, Iris Biotech, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 100mg, 5g, 10g.
2-[(9H-fluoren-9-ylmethoxycarbonylamino)methyl]benzoic acid (CAS 219640-94-5) is a chemical compound with the molecular formula C23H19NO4 and a molecular weight of 373.4 g/mol. IUPAC name: 2-[(9H-fluoren-9-ylmethoxycarbonylamino)methyl]benzoic acid. InChIKey: ZPHFVZKLOMMGCU-UHFFFAOYSA-N.
| Molecular formula | C23H19NO4 |
|---|---|
| Molecular weight | 373.4 g/mol |
| IUPAC name | 2-[(9H-fluoren-9-ylmethoxycarbonylamino)methyl]benzoic acid |
| InChIKey | ZPHFVZKLOMMGCU-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)CNC(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24)C(=O)O |
Computed by PubChem (NCBI)