CAS 1185303-23-4 appears in our catalog under these names: Fmoc-(2-aminophenyl)acetic acid, 95%, Fmoc-2-APAc-OH, Fmoc-(2-aminophenyl)acetic acid, 2-(Fmoc-amino)benzeneacetic acid 95%, Fmoc-2-aminophenylacetic acid, 97%. Offered by: Combi-blocks, Iris Biotech, Biosynth, Ambeed, Fluorochem. Available pack sizes: 1g, 5g, 100mg, 250mg, 0,5g, 500mg.
2-[2-(9H-fluoren-9-ylmethoxycarbonylamino)phenyl]acetic acid (CAS 1185303-23-4) is a chemical compound with the molecular formula C23H19NO4 and a molecular weight of 373.4 g/mol. IUPAC name: 2-[2-(9H-fluoren-9-ylmethoxycarbonylamino)phenyl]acetic acid. InChIKey: LFLJMIMQXJBATH-UHFFFAOYSA-N.
| Molecular formula | C23H19NO4 |
|---|---|
| Molecular weight | 373.4 g/mol |
| IUPAC name | 2-[2-(9H-fluoren-9-ylmethoxycarbonylamino)phenyl]acetic acid |
| InChIKey | LFLJMIMQXJBATH-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)CC(=O)O)NC(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24 |
Computed by PubChem (NCBI)