Products 332121-91-2
CAS 332121-91-2 appears in our catalog under these names: Fmoc-2-amino-5-methylbenzoic acid, Fmoc-2-amino-5-methylbenzoic acid, 95%. Offered by: Biosynth, Combi-blocks. Available pack sizes: 10g, 1g, 5g, 250mg, 100mg.
2-(9H-fluoren-9-ylmethoxycarbonylamino)-5-methylbenzoic acid (CAS 332121-91-2) is a chemical compound with the molecular formula C23H19NO4 and a molecular weight of 373.4 g/mol. IUPAC name: 2-(9H-fluoren-9-ylmethoxycarbonylamino)-5-methylbenzoic acid. InChIKey: LUZFNFRMORUWNG-UHFFFAOYSA-N.
| Molecular formula | C23H19NO4 |
|---|---|
| Molecular weight | 373.4 g/mol |
| IUPAC name | 2-(9H-fluoren-9-ylmethoxycarbonylamino)-5-methylbenzoic acid |
| InChIKey | LUZFNFRMORUWNG-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1)NC(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24)C(=O)O |
Computed by PubChem (NCBI)