CAS 1072944-36-5 is the registry number for N-(Furan-2-ylmethyl) 4-bromo-3-methoxybenzamide, 98%. Offered by: Combi-blocks. Available pack sizes: 1g, 100g, 25g, 5g.
4-bromo-N-(furan-2-ylmethyl)-3-methoxybenzamide (CAS 1072944-36-5) is a chemical compound with the molecular formula C13H12BrNO3 and a molecular weight of 310.14 g/mol. IUPAC name: 4-bromo-N-(furan-2-ylmethyl)-3-methoxybenzamide. InChIKey: YVMYXOXEBXTIEM-UHFFFAOYSA-N.
| Molecular formula | C13H12BrNO3 |
|---|---|
| Molecular weight | 310.14 g/mol |
| IUPAC name | 4-bromo-N-(furan-2-ylmethyl)-3-methoxybenzamide |
| InChIKey | YVMYXOXEBXTIEM-UHFFFAOYSA-N |
| SMILES | COC1=C(C=CC(=C1)C(=O)NCC2=CC=CO2)Br |
Computed by PubChem (NCBI)