CAS 41306-64-3 is the registry number for 2-(5-Bromo-4-oxopentyl)-1h-isoindole-1,3(2h)-dione, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g, 250mg, 100mg.
2-(5-bromo-4-oxopentyl)isoindole-1,3-dione (CAS 41306-64-3) is a chemical compound with the molecular formula C13H12BrNO3 and a molecular weight of 310.14 g/mol. IUPAC name: 2-(5-bromo-4-oxopentyl)isoindole-1,3-dione. InChIKey: PSKJVCNFAMZUFJ-UHFFFAOYSA-N.
| Molecular formula | C13H12BrNO3 |
|---|---|
| Molecular weight | 310.14 g/mol |
| IUPAC name | 2-(5-bromo-4-oxopentyl)isoindole-1,3-dione |
| InChIKey | PSKJVCNFAMZUFJ-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=O)N(C2=O)CCCC(=O)CBr |
Computed by PubChem (NCBI)