CAS 1708373-04-9 is the registry number for Ethyl 8-bromo-4-hydroxy-7-methylquinoline-3-carboxylate, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g, 10g, 25g.
Ethyl 8-bromo-7-methyl-4-oxo-1H-quinoline-3-carboxylate (CAS 1708373-04-9) is a chemical compound with the molecular formula C13H12BrNO3 and a molecular weight of 310.14 g/mol. IUPAC name: ethyl 8-bromo-7-methyl-4-oxo-1H-quinoline-3-carboxylate. InChIKey: OWIUEZFVDQPAHV-UHFFFAOYSA-N.
| Molecular formula | C13H12BrNO3 |
|---|---|
| Molecular weight | 310.14 g/mol |
| IUPAC name | ethyl 8-bromo-7-methyl-4-oxo-1H-quinoline-3-carboxylate |
| InChIKey | OWIUEZFVDQPAHV-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CNC2=C(C1=O)C=CC(=C2Br)C |
Computed by PubChem (NCBI)