CAS 1372890-25-9 is the registry number for Methyl 2-(2-bromoethyl)-1-oxo-1,2-dihydroisoquinoline-7-carboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Methyl 2-(2-bromoethyl)-1-oxoisoquinoline-7-carboxylate (CAS 1372890-25-9) is a chemical compound with the molecular formula C13H12BrNO3 and a molecular weight of 310.14 g/mol. IUPAC name: methyl 2-(2-bromoethyl)-1-oxoisoquinoline-7-carboxylate. InChIKey: XEDIRXVUJKWIIO-UHFFFAOYSA-N.
| Molecular formula | C13H12BrNO3 |
|---|---|
| Molecular weight | 310.14 g/mol |
| IUPAC name | methyl 2-(2-bromoethyl)-1-oxoisoquinoline-7-carboxylate |
| InChIKey | XEDIRXVUJKWIIO-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC2=C(C=C1)C=CN(C2=O)CCBr |
Computed by PubChem (NCBI)