CAS 923804-92-6 is the registry number for 1-(6-Bromobenzo[d][1,3]dioxol-5-yl)-N-(furan-2-ylmethyl)methanamine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
N-[(6-bromo-1,3-benzodioxol-5-yl)methyl]-1-(furan-2-yl)methanamine (CAS 923804-92-6) is a chemical compound with the molecular formula C13H12BrNO3 and a molecular weight of 310.14 g/mol. IUPAC name: N-[(6-bromo-1,3-benzodioxol-5-yl)methyl]-1-(furan-2-yl)methanamine. InChIKey: WBJLRRODROOGOP-UHFFFAOYSA-N.
| Molecular formula | C13H12BrNO3 |
|---|---|
| Molecular weight | 310.14 g/mol |
| IUPAC name | N-[(6-bromo-1,3-benzodioxol-5-yl)methyl]-1-(furan-2-yl)methanamine |
| InChIKey | WBJLRRODROOGOP-UHFFFAOYSA-N |
| SMILES | C1OC2=C(O1)C=C(C(=C2)CNCC3=CC=CO3)Br |
Computed by PubChem (NCBI)