CAS 59827-93-9 appears in our catalog under these names: Procaterol Impurity 2, Procaterol Impurity 4, Promethazine Impurity 7, 5-(2-Bromo-1-oxobutyl)-8-hydroxy-2(1H)-quinolinone. Offered by: Chemat Brand, Hubei YoungXin, TRC. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg, 5mg.
5-(2-bromobutanoyl)-8-hydroxy-1H-quinolin-2-one (CAS 59827-93-9) is a chemical compound with the molecular formula C13H12BrNO3 and a molecular weight of 310.14 g/mol. IUPAC name: 5-(2-bromobutanoyl)-8-hydroxy-1H-quinolin-2-one. InChIKey: XWOOUIQZGIEBND-UHFFFAOYSA-N.
| Molecular formula | C13H12BrNO3 |
|---|---|
| Molecular weight | 310.14 g/mol |
| IUPAC name | 5-(2-bromobutanoyl)-8-hydroxy-1H-quinolin-2-one |
| InChIKey | XWOOUIQZGIEBND-UHFFFAOYSA-N |
| SMILES | CCC(C(=O)C1=C2C=CC(=O)NC2=C(C=C1)O)Br |
Computed by PubChem (NCBI)