CAS 80022-73-7 is the registry number for Ethyl 2-(4-bromophenyl)-5-methyloxazole-4-carboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Ethyl 2-(4-bromophenyl)-5-methyl-1,3-oxazole-4-carboxylate (CAS 80022-73-7) is a chemical compound with the molecular formula C13H12BrNO3 and a molecular weight of 310.14 g/mol. IUPAC name: ethyl 2-(4-bromophenyl)-5-methyl-1,3-oxazole-4-carboxylate. InChIKey: CFBVDJAFDNBQCL-UHFFFAOYSA-N.
| Molecular formula | C13H12BrNO3 |
|---|---|
| Molecular weight | 310.14 g/mol |
| IUPAC name | ethyl 2-(4-bromophenyl)-5-methyl-1,3-oxazole-4-carboxylate |
| InChIKey | CFBVDJAFDNBQCL-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(OC(=N1)C2=CC=C(C=C2)Br)C |
Computed by PubChem (NCBI)