CAS 1189107-52-5 appears in our catalog under these names: 7-Bromo-4-hydroxy-8-methylquinoline-3-carboxylic acid ethyl ester, 95%, Ethyl 7-Bromo-4-Hydroxy-8-Methylquinoline-3-Carboxylate. Offered by: Combi-blocks, Chemat. Available pack sizes: 250mg, 1g.
Ethyl 7-bromo-8-methyl-4-oxo-1H-quinoline-3-carboxylate (CAS 1189107-52-5) is a chemical compound with the molecular formula C13H12BrNO3 and a molecular weight of 310.14 g/mol. IUPAC name: ethyl 7-bromo-8-methyl-4-oxo-1H-quinoline-3-carboxylate. InChIKey: HNKBNGWIOXRRSV-UHFFFAOYSA-N.
| Molecular formula | C13H12BrNO3 |
|---|---|
| Molecular weight | 310.14 g/mol |
| IUPAC name | ethyl 7-bromo-8-methyl-4-oxo-1H-quinoline-3-carboxylate |
| InChIKey | HNKBNGWIOXRRSV-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CNC2=C(C1=O)C=CC(=C2C)Br |
Computed by PubChem (NCBI)