Products 1509931-31-0
CAS 1509931-31-0 appears in our catalog under these names: [4-[(Ethylsulfonylamino)methyl]phenyl]boronic acid, 95%, (4-(Ethylsulfonamidomethyl)phenyl)boronic acid, 98%, (4–(Ethylsulfonamidomethyl)phenyl)boronic acid, (4-(Ethylsulfonamidomethyl)phenyl)boronic acid, 98%, 98%. Offered by: Combi-blocks, AmBeed, GLPBio, Chemat. Available pack sizes: 1g, 250mg, 100mg.
[4-[(ethylsulfonylamino)methyl]phenyl]boronic acid (CAS 1509931-31-0) is a chemical compound with the molecular formula C9H14BNO4S and a molecular weight of 243.09 g/mol. IUPAC name: [4-[(ethylsulfonylamino)methyl]phenyl]boronic acid. InChIKey: QHCYTDXDVUMVMA-UHFFFAOYSA-N.
| Molecular formula | C9H14BNO4S |
|---|---|
| Molecular weight | 243.09 g/mol |
| IUPAC name | [4-[(ethylsulfonylamino)methyl]phenyl]boronic acid |
| InChIKey | QHCYTDXDVUMVMA-UHFFFAOYSA-N |
| SMILES | B(C1=CC=C(C=C1)CNS(=O)(=O)CC)(O)O |
Computed by PubChem (NCBI)