Products 1704069-04-4
CAS 1704069-04-4 appears in our catalog under these names: (3，5–Dimethyl–4–(N–methylsulfamoyl)phenyl)boronic acid, (3,5-Dimethyl-4-(n-methylsulfamoyl)phenyl)boronic acid, 95%. Offered by: GLPBio, Combi-blocks. Available pack sizes: 500mg, 1g, 250mg.
[3,5-dimethyl-4-(methylsulfamoyl)phenyl]boronic acid (CAS 1704069-04-4) is a chemical compound with the molecular formula C9H14BNO4S and a molecular weight of 243.09 g/mol. IUPAC name: [3,5-dimethyl-4-(methylsulfamoyl)phenyl]boronic acid. InChIKey: QGIUBYNIRFZDBP-UHFFFAOYSA-N.
| Molecular formula | C9H14BNO4S |
|---|---|
| Molecular weight | 243.09 g/mol |
| IUPAC name | [3,5-dimethyl-4-(methylsulfamoyl)phenyl]boronic acid |
| InChIKey | QGIUBYNIRFZDBP-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C(=C1)C)S(=O)(=O)NC)C)(O)O |
Computed by PubChem (NCBI)