CAS 889451-13-2 appears in our catalog under these names: (5-((tert-Butoxycarbonyl)amino)thiophen-3-yl)boronic acid, 98%, 98%, (5-((tert-Butoxycarbonyl)amino)thiophen-3-yl)boronic acid, 98%. Offered by: Chemat, Ambeed. Available pack sizes: 250mg, 1g, 5g.
[5-[(2-methylpropan-2-yl)oxycarbonylamino]thiophen-3-yl]boronic acid (CAS 889451-13-2) is a chemical compound with the molecular formula C9H14BNO4S and a molecular weight of 243.09 g/mol. IUPAC name: [5-[(2-methylpropan-2-yl)oxycarbonylamino]thiophen-3-yl]boronic acid. InChIKey: JWCSTSSEVZMQQJ-UHFFFAOYSA-N.
| Molecular formula | C9H14BNO4S |
|---|---|
| Molecular weight | 243.09 g/mol |
| IUPAC name | [5-[(2-methylpropan-2-yl)oxycarbonylamino]thiophen-3-yl]boronic acid |
| InChIKey | JWCSTSSEVZMQQJ-UHFFFAOYSA-N |
| SMILES | B(C1=CSC(=C1)NC(=O)OC(C)(C)C)(O)O |
Computed by PubChem (NCBI)