Products 2377610-24-5
CAS 2377610-24-5 is the registry number for 2-(Dimethylsulfamoyl)-5-methylphenylboronic acid, 98%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
[2-(dimethylsulfamoyl)-5-methylphenyl]boronic acid (CAS 2377610-24-5) is a chemical compound with the molecular formula C9H14BNO4S and a molecular weight of 243.09 g/mol. IUPAC name: [2-(dimethylsulfamoyl)-5-methylphenyl]boronic acid. InChIKey: YJYXMOYWACGPLO-UHFFFAOYSA-N.
| Molecular formula | C9H14BNO4S |
|---|---|
| Molecular weight | 243.09 g/mol |
| IUPAC name | [2-(dimethylsulfamoyl)-5-methylphenyl]boronic acid |
| InChIKey | YJYXMOYWACGPLO-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=CC(=C1)C)S(=O)(=O)N(C)C)(O)O |
Computed by PubChem (NCBI)