CAS 108099-55-4 appears in our catalog under these names: 6-(Bromomethyl)-4-chlorothieno(2,3-d)pyrimidine, 6-(Bromomethyl)-4-chlorothieno(2,3-d)pyrimidine, 95%. Offered by: Biosynth, AmBeed. Available pack sizes: 0,5g, 50mg, 1g.
6-(bromomethyl)-4-chlorothieno[2,3-d]pyrimidine (CAS 108099-55-4) is a chemical compound with the molecular formula C7H4BrClN2S and a molecular weight of 263.54 g/mol. IUPAC name: 6-(bromomethyl)-4-chlorothieno[2,3-d]pyrimidine. InChIKey: SUKISGZALSMAEM-UHFFFAOYSA-N.
| Molecular formula | C7H4BrClN2S |
|---|---|
| Molecular weight | 263.54 g/mol |
| IUPAC name | 6-(bromomethyl)-4-chlorothieno[2,3-d]pyrimidine |
| InChIKey | SUKISGZALSMAEM-UHFFFAOYSA-N |
| SMILES | C1=C(SC2=C1C(=NC=N2)Cl)CBr |
Computed by PubChem (NCBI)