CAS 38338-20-4 appears in our catalog under these names: 4–bromo–6–chlorobenzo(d)thiazol–2–amine, 4-Bromo-6-chloro-1,3-benzothiazol-2-amine, 95%, 4-Bromo-6-chlorobenzo(d)thiazol-2-amine, 95+%. Offered by: GLPBio, Combi-blocks, AmBeed. Available pack sizes: 1g, 250mg, 5g.
4-bromo-6-chloro-1,3-benzothiazol-2-amine (CAS 38338-20-4) is a chemical compound with the molecular formula C7H4BrClN2S and a molecular weight of 263.54 g/mol. IUPAC name: 4-bromo-6-chloro-1,3-benzothiazol-2-amine. InChIKey: OTXODMAJTODLKG-UHFFFAOYSA-N.
| Molecular formula | C7H4BrClN2S |
|---|---|
| Molecular weight | 263.54 g/mol |
| IUPAC name | 4-bromo-6-chloro-1,3-benzothiazol-2-amine |
| InChIKey | OTXODMAJTODLKG-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C2=C1SC(=N2)N)Br)Cl |
Computed by PubChem (NCBI)