CAS 1342623-73-7 is the registry number for 7-Bromo-4-chloro-1,3-benzothiazol-2-amine, 95%. Offered by: AmBeed. Available pack sizes: 5g.
7-bromo-4-chloro-1,3-benzothiazol-2-amine (CAS 1342623-73-7) is a chemical compound with the molecular formula C7H4BrClN2S and a molecular weight of 263.54 g/mol. IUPAC name: 7-bromo-4-chloro-1,3-benzothiazol-2-amine. InChIKey: IRRIHAXGKUQPLS-UHFFFAOYSA-N.
| Molecular formula | C7H4BrClN2S |
|---|---|
| Molecular weight | 263.54 g/mol |
| IUPAC name | 7-bromo-4-chloro-1,3-benzothiazol-2-amine |
| InChIKey | IRRIHAXGKUQPLS-UHFFFAOYSA-N |
| SMILES | C1=CC(=C2C(=C1Cl)N=C(S2)N)Br |
Computed by PubChem (NCBI)