CAS 1388892-94-1 appears in our catalog under these names: 5-Bromo-4-chloro-6-methylthieno[2,3-d]pyrimidine, 95%, 5-bromo-4-chloro-6-methylthieno(2,3-d)pyrimidine, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 100mg, 250mg, 5g.
5-bromo-4-chloro-6-methylthieno[2,3-d]pyrimidine (CAS 1388892-94-1) is a chemical compound with the molecular formula C7H4BrClN2S and a molecular weight of 263.54 g/mol. IUPAC name: 5-bromo-4-chloro-6-methylthieno[2,3-d]pyrimidine. InChIKey: DJIDMQBJWKUZRQ-UHFFFAOYSA-N.
| Molecular formula | C7H4BrClN2S |
|---|---|
| Molecular weight | 263.54 g/mol |
| IUPAC name | 5-bromo-4-chloro-6-methylthieno[2,3-d]pyrimidine |
| InChIKey | DJIDMQBJWKUZRQ-UHFFFAOYSA-N |
| SMILES | CC1=C(C2=C(S1)N=CN=C2Cl)Br |
Computed by PubChem (NCBI)