CAS 1427383-32-1 is the registry number for 4-Bromo-7-chlorobenzo[d]thiazol-2-amine 98%. Offered by: Ambeed. Available pack sizes: 50mg, 100mg, 250mg, 1g.
4-bromo-7-chloro-1,3-benzothiazol-2-amine (CAS 1427383-32-1) is a chemical compound with the molecular formula C7H4BrClN2S and a molecular weight of 263.54 g/mol. IUPAC name: 4-bromo-7-chloro-1,3-benzothiazol-2-amine. InChIKey: SEAQXGQIPXOIFN-UHFFFAOYSA-N.
| Molecular formula | C7H4BrClN2S |
|---|---|
| Molecular weight | 263.54 g/mol |
| IUPAC name | 4-bromo-7-chloro-1,3-benzothiazol-2-amine |
| InChIKey | SEAQXGQIPXOIFN-UHFFFAOYSA-N |
| SMILES | C1=CC(=C2C(=C1Cl)SC(=N2)N)Br |
Computed by PubChem (NCBI)