Products 1356017-04-3
CAS 1356017-04-3 appears in our catalog under these names: 7-(Bromomethyl)-2-chlorothieno[3,2-d]pyrimidine, 95%, 7-(Bromomethyl)-2-chlorothieno(3,2-d)pyrimidine, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g.
7-(bromomethyl)-2-chlorothieno[3,2-d]pyrimidine (CAS 1356017-04-3) is a chemical compound with the molecular formula C7H4BrClN2S and a molecular weight of 263.54 g/mol. IUPAC name: 7-(bromomethyl)-2-chlorothieno[3,2-d]pyrimidine. InChIKey: CDBPJDYMMIHRPG-UHFFFAOYSA-N.
| Molecular formula | C7H4BrClN2S |
|---|---|
| Molecular weight | 263.54 g/mol |
| IUPAC name | 7-(bromomethyl)-2-chlorothieno[3,2-d]pyrimidine |
| InChIKey | CDBPJDYMMIHRPG-UHFFFAOYSA-N |
| SMILES | C1=C2C(=NC(=N1)Cl)C(=CS2)CBr |
Computed by PubChem (NCBI)